C14H21N3O4 — CID 138993064
5-[[(2,2-dimethyloxan-4-yl)carbamoylamino]methyl]furan-2-carboxamide (PubChem CID 138993064) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-[[(2,2-dimethyloxan-4-yl)carbamoylamino]methyl]furan-2-carboxamide.
| Compound Name | 5-[[(2,2-dimethyloxan-4-yl)carbamoylamino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 138993064 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 5-[[(2,2-dimethyloxan-4-yl)carbamoylamino]methyl]furan-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)NCc2ccc(C(N)=O)o2)CCO1 |
| InChI | InChI=1S/C14H21N3O4/c1-14(2)7-9(5-6-20-14)17-13(19)16-8-10-3-4-11(21-10)12(15)18/h3-4,9H,5-8H2,1-2H3,(H2,15,18)(H2,16,17,19) |
| InChIKey | JSFHSSDVJIQVSR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |