C27H36N4O4 — CID 138996096
N-cyclohexyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide (PubChem CID 138996096) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 138996096 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N-cyclohexyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide |
| SMILES | CCOc1cc(C(=O)N2CCN(CC(=O)NC3CCCCC3)CC2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C27H36N4O4/c1-2-34-25-17-22(10-11-24(25)35-20-21-7-6-12-28-18-21)27(33)31-15-13-30(14-16-31)19-26(32)29-23-8-4-3-5-9-23/h6-7,10-12,17-18,23H,2-5,8-9,13-16,19-20H2,1H3,(H,29,32) |
| InChIKey | VTEMKEZWXRALEI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |