C28H32N4O4 — CID 30838266
N-benzyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide (PubChem CID 30838266) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-benzyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30838266 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-benzyl-2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]acetamide |
| SMILES | CCOc1cc(C(=O)N2CCN(CC(=O)NCc3ccccc3)CC2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C28H32N4O4/c1-2-35-26-17-24(10-11-25(26)36-21-23-9-6-12-29-18-23)28(34)32-15-13-31(14-16-32)20-27(33)30-19-22-7-4-3-5-8-22/h3-12,17-18H,2,13-16,19-21H2,1H3,(H,30,33) |
| InChIKey | ZYNXMVNIKWFADB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |