C24H30N4O4 — CID 55683067
2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55683067) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55683067 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[4-[3-ethoxy-4-(pyridin-3-ylmethoxy)benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)c2ccc(OCc3cccnc3)c(OCC)c2)CC1 |
| InChI | InChI=1S/C24H30N4O4/c1-3-9-26-23(29)17-27-11-13-28(14-12-27)24(30)20-7-8-21(22(15-20)31-4-2)32-18-19-6-5-10-25-16-19/h3,5-8,10,15-16H,1,4,9,11-14,17-18H2,2H3,(H,26,29) |
| InChIKey | NKPJDHMSWGWIGL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|