C21H21ClN4O3 — CID 139000111
3-(4-chlorophenyl)-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzimidazole-5-carboxamide (PubChem CID 139000111) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzimidazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 139000111 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-methyl-N-(2-morpholin-4-yl-2-oxoethyl)benzimidazole-5-carboxamide |
| SMILES | CN(CC(=O)N1CCOCC1)C(=O)c1ccc2ncn(-c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C21H21ClN4O3/c1-24(13-20(27)25-8-10-29-11-9-25)21(28)15-2-7-18-19(12-15)26(14-23-18)17-5-3-16(22)4-6-17/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | JLBDLAMCOSAYEI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |