C18H25N5 — CID 139007908
1-(1-cyclopropyltetrazol-5-yl)-N-[(1-phenylcyclopentyl)methyl]ethanamine (PubChem CID 139007908) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(1-cyclopropyltetrazol-5-yl)-N-[(1-phenylcyclopentyl)methyl]ethanamine.
| Compound Name | 1-(1-cyclopropyltetrazol-5-yl)-N-[(1-phenylcyclopentyl)methyl]ethanamine |
|---|---|
| PubChem CID | 139007908 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1-(1-cyclopropyltetrazol-5-yl)-N-[(1-phenylcyclopentyl)methyl]ethanamine |
| SMILES | CC(NCC1(c2ccccc2)CCCC1)c1nnnn1C1CC1 |
| InChI | InChI=1S/C18H25N5/c1-14(17-20-21-22-23(17)16-9-10-16)19-13-18(11-5-6-12-18)15-7-3-2-4-8-15/h2-4,7-8,14,16,19H,5-6,9-13H2,1H3 |
| InChIKey | ODZAPNDQSWACSY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |