C18H22N4O2 — CID 139008161
2-methyl-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 139008161) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-methyl-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 2-methyl-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 139008161 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-methyl-N-(2-oxo-5,6,7,8-tetrahydro-1H-quinolin-5-yl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | Cn1nc2c(c1C(=O)NC1CCCc3[nH]c(=O)ccc31)CCCC2 |
| InChI | InChI=1S/C18H22N4O2/c1-22-17(12-5-2-3-6-15(12)21-22)18(24)20-14-8-4-7-13-11(14)9-10-16(23)19-13/h9-10,14H,2-8H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | XPYYYLVRGIIXPU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |