C10H14N2O — CID 89053172
(5S)-5-(methylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 89053172) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (5S)-5-(methylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | (5S)-5-(methylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 89053172 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (5S)-5-(methylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | CN[C@H]1CCCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C10H14N2O/c1-11-8-3-2-4-9-7(8)5-6-10(13)12-9/h5-6,8,11H,2-4H2,1H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | ZKJHLUMJLGXYBY-QMMMGPOBSA-N |
| XLogP | 0.97 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |