C15H13F2NO4S — CID 139010819
4-[(3-ethylphenyl)sulfonylamino]-2,6-difluorobenzoic acid (PubChem CID 139010819) has the molecular formula C15H13F2NO4S and a molecular weight of 341.34 g/mol. Its IUPAC name is 4-[(3-ethylphenyl)sulfonylamino]-2,6-difluorobenzoic acid.
| Compound Name | 4-[(3-ethylphenyl)sulfonylamino]-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 139010819 |
| Molecular Formula | C15H13F2NO4S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[(3-ethylphenyl)sulfonylamino]-2,6-difluorobenzoic acid |
| SMILES | CCc1cccc(S(=O)(=O)Nc2cc(F)c(C(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C15H13F2NO4S/c1-2-9-4-3-5-11(6-9)23(21,22)18-10-7-12(16)14(15(19)20)13(17)8-10/h3-8,18H,2H2,1H3,(H,19,20) |
| InChIKey | QQCGKJKSUBMJDH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |