C16H19N3O3S2 — CID 139011765
N-ethyl-1-(5-phenyl-1,3-thiazole-4-carbonyl)pyrrolidine-3-sulfonamide (PubChem CID 139011765) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-ethyl-1-(5-phenyl-1,3-thiazole-4-carbonyl)pyrrolidine-3-sulfonamide.
| Compound Name | N-ethyl-1-(5-phenyl-1,3-thiazole-4-carbonyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 139011765 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-ethyl-1-(5-phenyl-1,3-thiazole-4-carbonyl)pyrrolidine-3-sulfonamide |
| SMILES | CCNS(=O)(=O)C1CCN(C(=O)c2ncsc2-c2ccccc2)C1 |
| InChI | InChI=1S/C16H19N3O3S2/c1-2-18-24(21,22)13-8-9-19(10-13)16(20)14-15(23-11-17-14)12-6-4-3-5-7-12/h3-7,11,13,18H,2,8-10H2,1H3 |
| InChIKey | QAJPTILBMDVTLQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |