C17H23N3O4S — CID 166420720
N-[2-[2-[3-(ethylsulfamoyl)pyrrolidin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166420720) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[2-[2-[3-(ethylsulfamoyl)pyrrolidin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-[3-(ethylsulfamoyl)pyrrolidin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166420720 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[2-[2-[3-(ethylsulfamoyl)pyrrolidin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1CC(=O)N1CCC(S(=O)(=O)NCC)C1 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-16(21)19-15-8-6-5-7-13(15)11-17(22)20-10-9-14(12-20)25(23,24)18-4-2/h3,5-8,14,18H,1,4,9-12H2,2H3,(H,19,21) |
| InChIKey | MONDMHVFDCQABP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|