C23H27N3O4 — CID 166420856
2,5-dimethyl-N-[1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]piperidin-4-yl]furan-3-carboxamide (PubChem CID 166420856) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]piperidin-4-yl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]piperidin-4-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 166420856 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2,5-dimethyl-N-[1-[2-[2-(prop-2-enoylamino)phenyl]acetyl]piperidin-4-yl]furan-3-carboxamide |
| SMILES | C=CC(=O)Nc1ccccc1CC(=O)N1CCC(NC(=O)c2cc(C)oc2C)CC1 |
| InChI | InChI=1S/C23H27N3O4/c1-4-21(27)25-20-8-6-5-7-17(20)14-22(28)26-11-9-18(10-12-26)24-23(29)19-13-15(2)30-16(19)3/h4-8,13,18H,1,9-12,14H2,2-3H3,(H,24,29)(H,25,27) |
| InChIKey | GZSZPSQSOVUHAI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|