C16H11F4N3O — CID 139012294
N'-[4-cyano-2-(trifluoromethyl)phenyl]-4-fluoro-3-methylbenzohydrazide (PubChem CID 139012294) has the molecular formula C16H11F4N3O and a molecular weight of 337.28 g/mol. Its IUPAC name is N'-[4-cyano-2-(trifluoromethyl)phenyl]-4-fluoro-3-methylbenzohydrazide.
| Compound Name | N'-[4-cyano-2-(trifluoromethyl)phenyl]-4-fluoro-3-methylbenzohydrazide |
|---|---|
| PubChem CID | 139012294 |
| Molecular Formula | C16H11F4N3O |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N'-[4-cyano-2-(trifluoromethyl)phenyl]-4-fluoro-3-methylbenzohydrazide |
| SMILES | Cc1cc(C(=O)NNc2ccc(C#N)cc2C(F)(F)F)ccc1F |
| InChI | InChI=1S/C16H11F4N3O/c1-9-6-11(3-4-13(9)17)15(24)23-22-14-5-2-10(8-21)7-12(14)16(18,19)20/h2-7,22H,1H3,(H,23,24) |
| InChIKey | NPNVVZSBJGFIDE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|