C15H7BrClF4N3O — CID 167748702
2-bromo-5-chloro-N'-[4-cyano-2-(trifluoromethyl)phenyl]-3-fluorobenzohydrazide (PubChem CID 167748702) has the molecular formula C15H7BrClF4N3O and a molecular weight of 436.59 g/mol. Its IUPAC name is 2-bromo-5-chloro-N'-[4-cyano-2-(trifluoromethyl)phenyl]-3-fluorobenzohydrazide.
| Compound Name | 2-bromo-5-chloro-N'-[4-cyano-2-(trifluoromethyl)phenyl]-3-fluorobenzohydrazide |
|---|---|
| PubChem CID | 167748702 |
| Molecular Formula | C15H7BrClF4N3O |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 434.94 |
| IUPAC Name | 2-bromo-5-chloro-N'-[4-cyano-2-(trifluoromethyl)phenyl]-3-fluorobenzohydrazide |
| SMILES | N#Cc1ccc(NNC(=O)c2cc(Cl)cc(F)c2Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H7BrClF4N3O/c16-13-9(4-8(17)5-11(13)18)14(25)24-23-12-2-1-7(6-22)3-10(12)15(19,20)21/h1-5,23H,(H,24,25) |
| InChIKey | AKZWWNPIDBNYDL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|