C17H7F7N4O — CID 169155589
4-cyano-N'-[4-cyano-3-fluoro-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzohydrazide (PubChem CID 169155589) has the molecular formula C17H7F7N4O and a molecular weight of 416.26 g/mol. Its IUPAC name is 4-cyano-N'-[4-cyano-3-fluoro-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzohydrazide.
| Compound Name | 4-cyano-N'-[4-cyano-3-fluoro-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 169155589 |
| Molecular Formula | C17H7F7N4O |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 4-cyano-N'-[4-cyano-3-fluoro-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzohydrazide |
| SMILES | N#Cc1ccc(C(=O)NNc2ccc(C#N)c(F)c2C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H7F7N4O/c18-14-10(7-26)3-4-12(13(14)17(22,23)24)27-28-15(29)8-1-2-9(6-25)11(5-8)16(19,20)21/h1-5,27H,(H,28,29) |
| InChIKey | XICANWWRSGSAIG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|