C11H14N4O4S2 — CID 139014035
3-[3-(1-methyl-1,2,4-triazol-3-yl)propylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 139014035) has the molecular formula C11H14N4O4S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[3-(1-methyl-1,2,4-triazol-3-yl)propylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[3-(1-methyl-1,2,4-triazol-3-yl)propylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 139014035 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-[3-(1-methyl-1,2,4-triazol-3-yl)propylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cn1cnc(CCCNS(=O)(=O)c2ccsc2C(=O)O)n1 |
| InChI | InChI=1S/C11H14N4O4S2/c1-15-7-12-9(14-15)3-2-5-13-21(18,19)8-4-6-20-10(8)11(16)17/h4,6-7,13H,2-3,5H2,1H3,(H,16,17) |
| InChIKey | SXBCLVUZKGLJHZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|