C11H12N2O5S2 — CID 139014227
(2S,3S)-2-(1,3-benzothiazol-4-ylsulfonylamino)-3-hydroxybutanoic acid (PubChem CID 139014227) has the molecular formula C11H12N2O5S2 and a molecular weight of 316.36 g/mol. Its IUPAC name is (2S,3S)-2-(1,3-benzothiazol-4-ylsulfonylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3S)-2-(1,3-benzothiazol-4-ylsulfonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 139014227 |
| Molecular Formula | C11H12N2O5S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (2S,3S)-2-(1,3-benzothiazol-4-ylsulfonylamino)-3-hydroxybutanoic acid |
| SMILES | C[C@H](O)[C@H](NS(=O)(=O)c1cccc2scnc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O5S2/c1-6(14)9(11(15)16)13-20(17,18)8-4-2-3-7-10(8)12-5-19-7/h2-6,9,13-14H,1H3,(H,15,16)/t6-,9-/m0/s1 |
| InChIKey | LXMUHLXXCMEBAH-RCOVLWMOSA-N |
| XLogP | 0.41 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |