C15H20BrN3O3 — CID 139017197
3-(3-bromo-4-ethoxy-5-methoxyphenyl)-5-(2-ethoxyethyl)-1H-1,2,4-triazole (PubChem CID 139017197) has the molecular formula C15H20BrN3O3 and a molecular weight of 370.25 g/mol. Its IUPAC name is 3-(3-bromo-4-ethoxy-5-methoxyphenyl)-5-(2-ethoxyethyl)-1H-1,2,4-triazole.
| Compound Name | 3-(3-bromo-4-ethoxy-5-methoxyphenyl)-5-(2-ethoxyethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 139017197 |
| Molecular Formula | C15H20BrN3O3 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-(3-bromo-4-ethoxy-5-methoxyphenyl)-5-(2-ethoxyethyl)-1H-1,2,4-triazole |
| SMILES | CCOCCc1nc(-c2cc(Br)c(OCC)c(OC)c2)n[nH]1 |
| InChI | InChI=1S/C15H20BrN3O3/c1-4-21-7-6-13-17-15(19-18-13)10-8-11(16)14(22-5-2)12(9-10)20-3/h8-9H,4-7H2,1-3H3,(H,17,18,19) |
| InChIKey | WAZIUIMHLBPNCG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|