C19H16F2N2O3S — CID 139020987
N-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-(4-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 139020987) has the molecular formula C19H16F2N2O3S and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-(4-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-(4-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 139020987 |
| Molecular Formula | C19H16F2N2O3S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[(4-cyano-2-fluorophenyl)methylsulfonyl]-2-(4-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | N#Cc1ccc(CS(=O)(=O)NC(=O)C2CCC2c2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C19H16F2N2O3S/c20-15-5-3-13(4-6-15)16-7-8-17(16)19(24)23-27(25,26)11-14-2-1-12(10-22)9-18(14)21/h1-6,9,16-17H,7-8,11H2,(H,23,24) |
| InChIKey | XNCXKTDZUBTENK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |