C17H20N4O2 — CID 139021622
(3aS,6aR)-N-(1-benzyltriazol-4-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxamide (PubChem CID 139021622) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3aS,6aR)-N-(1-benzyltriazol-4-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxamide.
| Compound Name | (3aS,6aR)-N-(1-benzyltriazol-4-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxamide |
|---|---|
| PubChem CID | 139021622 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3aS,6aR)-N-(1-benzyltriazol-4-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carboxamide |
| SMILES | O=C(Nc1cn(Cc2ccccc2)nn1)[C@]12CCC[C@H]1OCC2 |
| InChI | InChI=1S/C17H20N4O2/c22-16(17-8-4-7-14(17)23-10-9-17)18-15-12-21(20-19-15)11-13-5-2-1-3-6-13/h1-3,5-6,12,14H,4,7-11H2,(H,18,22)/t14-,17+/m1/s1 |
| InChIKey | VXAUAFYBMMGVBE-PBHICJAKSA-N |
| XLogP | 2.22 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |