C16H19N5S — CID 139022225
3-[2-(4-piperidin-4-yltriazol-1-yl)ethyl]-1,2-benzothiazole (PubChem CID 139022225) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is 3-[2-(4-piperidin-4-yltriazol-1-yl)ethyl]-1,2-benzothiazole.
| Compound Name | 3-[2-(4-piperidin-4-yltriazol-1-yl)ethyl]-1,2-benzothiazole |
|---|---|
| PubChem CID | 139022225 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-[2-(4-piperidin-4-yltriazol-1-yl)ethyl]-1,2-benzothiazole |
| SMILES | c1ccc2c(CCn3cc(C4CCNCC4)nn3)nsc2c1 |
| InChI | InChI=1S/C16H19N5S/c1-2-4-16-13(3-1)14(19-22-16)7-10-21-11-15(18-20-21)12-5-8-17-9-6-12/h1-4,11-12,17H,5-10H2 |
| InChIKey | BVQVLUGDZLJEMI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |