C17H20N6O2 — CID 97195182
3-[2-[4-[(3S)-piperidin-3-yl]triazol-1-yl]ethyl]-2H-phthalazine-1,4-dione (PubChem CID 97195182) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 3-[2-[4-[(3S)-piperidin-3-yl]triazol-1-yl]ethyl]-2H-phthalazine-1,4-dione.
| Compound Name | 3-[2-[4-[(3S)-piperidin-3-yl]triazol-1-yl]ethyl]-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 97195182 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-[2-[4-[(3S)-piperidin-3-yl]triazol-1-yl]ethyl]-2H-phthalazine-1,4-dione |
| SMILES | O=c1[nH]n(CCn2cc([C@H]3CCCNC3)nn2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H20N6O2/c24-16-13-5-1-2-6-14(13)17(25)23(20-16)9-8-22-11-15(19-21-22)12-4-3-7-18-10-12/h1-2,5-6,11-12,18H,3-4,7-10H2,(H,20,24)/t12-/m0/s1 |
| InChIKey | MGYDUKGWXIUMII-LBPRGKRZSA-N |
| XLogP | 0.45 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |