C38H49NO11S — CID 139025639
benzenesulfonate;5-prop-2-enoyloxypentyl 3-[(1R,2S)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoate (PubChem CID 139025639) has the molecular formula C38H49NO11S and a molecular weight of 727.87 g/mol. Its IUPAC name is benzenesulfonate;5-prop-2-enoyloxypentyl 3-[(1R,2S)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoate.
| Compound Name | benzenesulfonate;5-prop-2-enoyloxypentyl 3-[(1R,2S)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoate |
|---|---|
| PubChem CID | 139025639 |
| Molecular Formula | C38H49NO11S |
| Molecular Weight | 727.87 g/mol |
| Exact Mass | 727.30 |
| IUPAC Name | benzenesulfonate;5-prop-2-enoyloxypentyl 3-[(1R,2S)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoate |
| SMILES | C=CC(=O)OCCCCCOC(=O)CC[N@+]1(C)CCc2cc(OC)c(OC)cc2[C@H]1Cc1ccc(OC)c(OC)c1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C32H44NO8.C6H6O3S/c1-7-31(34)40-17-9-8-10-18-41-32(35)14-16-33(2)15-13-24-21-29(38-5)30(39-6)22-25(24)26(33)19-23-11-12-27(36-3)28(20-23)37-4;7-10(8,9)6-4-2-1-3-5-6/h7,11-12,20-22,26H,1,8-10,13-19H2,2-6H3;1-5H,(H,7,8,9)/q+1;/p-1/t26-,33+;/m1./s1 |
| InChIKey | OROOXZDLWOYLAH-ZQDOPVQASA-M |
| XLogP | 5.43 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.87 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|