C30H37NO7S — CID 162294300
benzenesulfonate;3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-2,6,7-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoic acid (PubChem CID 162294300) has the molecular formula C30H37NO7S and a molecular weight of 555.69 g/mol. Its IUPAC name is benzenesulfonate;3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-2,6,7-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoic acid.
| Compound Name | benzenesulfonate;3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-2,6,7-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoic acid |
|---|---|
| PubChem CID | 162294300 |
| Molecular Formula | C30H37NO7S |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | benzenesulfonate;3-[(1R,2R)-1-[(3,4-dimethoxyphenyl)methyl]-2,6,7-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propanoic acid |
| SMILES | COc1ccc(C[C@@H]2c3cc(C)c(C)cc3CC[N@+]2(C)CCC(=O)O)cc1OC.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C24H31NO4.C6H6O3S/c1-16-12-19-8-10-25(3,11-9-24(26)27)21(20(19)13-17(16)2)14-18-6-7-22(28-4)23(15-18)29-5;7-10(8,9)6-4-2-1-3-5-6/h6-7,12-13,15,21H,8-11,14H2,1-5H3;1-5H,(H,7,8,9)/t21-,25-;/m1./s1 |
| InChIKey | NQJDHGVVMNCLNA-UPWLLONGSA-N |
| XLogP | 4.67 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|