C27H36NO6+ — CID 88551464
3-[(1S,2S)-1-[[4-(hydroxymethyl)-3-methoxyphenyl]methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl prop-2-enoate (PubChem CID 88551464) has the molecular formula C27H36NO6+ and a molecular weight of 470.59 g/mol. Its IUPAC name is 3-[(1S,2S)-1-[[4-(hydroxymethyl)-3-methoxyphenyl]methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl prop-2-enoate.
| Compound Name | 3-[(1S,2S)-1-[[4-(hydroxymethyl)-3-methoxyphenyl]methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 88551464 |
| Molecular Formula | C27H36NO6+ |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 3-[(1S,2S)-1-[[4-(hydroxymethyl)-3-methoxyphenyl]methyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC[N@+]1(C)CCc2cc(OC)c(OC)cc2[C@@H]1Cc1ccc(CO)c(OC)c1 |
| InChI | InChI=1S/C27H36NO6/c1-6-27(30)34-13-7-11-28(2)12-10-20-16-25(32-4)26(33-5)17-22(20)23(28)14-19-8-9-21(18-29)24(15-19)31-3/h6,8-9,15-17,23,29H,1,7,10-14,18H2,2-5H3/q+1/t23-,28+/m0/s1 |
| InChIKey | MTMWYCXASIYJBV-NEKDWFFYSA-N |
| XLogP | 3.61 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|