C3H5BrClN3O2S — CID 139026259
3-bromo-5-methylsulfonyl-1H-1,2,4-triazole;hydrochloride (PubChem CID 139026259) has the molecular formula C3H5BrClN3O2S and a molecular weight of 262.52 g/mol. Its IUPAC name is 3-bromo-5-methylsulfonyl-1H-1,2,4-triazole;hydrochloride.
| Compound Name | 3-bromo-5-methylsulfonyl-1H-1,2,4-triazole;hydrochloride |
|---|---|
| PubChem CID | 139026259 |
| Molecular Formula | C3H5BrClN3O2S |
| Molecular Weight | 262.52 g/mol |
| Exact Mass | 260.90 |
| IUPAC Name | 3-bromo-5-methylsulfonyl-1H-1,2,4-triazole;hydrochloride |
| SMILES | CS(=O)(=O)c1nc(Br)n[nH]1.Cl |
| InChI | InChI=1S/C3H4BrN3O2S.ClH/c1-10(8,9)3-5-2(4)6-7-3;/h1H3,(H,5,6,7);1H |
| InChIKey | QKQKIEWJYKDFNZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.52 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |