C8H14N4O2 — CID 139026545
4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]oxan-4-ol (PubChem CID 139026545) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]oxan-4-ol.
| Compound Name | 4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]oxan-4-ol |
|---|---|
| PubChem CID | 139026545 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 4-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]oxan-4-ol |
| SMILES | NCc1nc(C2(O)CCOCC2)n[nH]1 |
| InChI | InChI=1S/C8H14N4O2/c9-5-6-10-7(12-11-6)8(13)1-3-14-4-2-8/h13H,1-5,9H2,(H,10,11,12) |
| InChIKey | RKMNXQDQBNIGNF-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |