C8H15N5O — CID 115440677
5-[4-(aminomethyl)oxan-4-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 115440677) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-[4-(aminomethyl)oxan-4-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[4-(aminomethyl)oxan-4-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115440677 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 5-[4-(aminomethyl)oxan-4-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | NCC1(c2nc(N)n[nH]2)CCOCC1 |
| InChI | InChI=1S/C8H15N5O/c9-5-8(1-3-14-4-2-8)6-11-7(10)13-12-6/h1-5,9H2,(H3,10,11,12,13) |
| InChIKey | MCSOIFNCZKBLQM-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |