C8H14N4O2S — CID 115037843
5-(4-methyl-1,1-dioxothian-4-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 115037843) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-(4-methyl-1,1-dioxothian-4-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-methyl-1,1-dioxothian-4-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115037843 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-(4-methyl-1,1-dioxothian-4-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | CC1(c2nc(N)n[nH]2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H14N4O2S/c1-8(6-10-7(9)12-11-6)2-4-15(13,14)5-3-8/h2-5H2,1H3,(H3,9,10,11,12) |
| InChIKey | PKTXALJBVOMKRO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |