C18H25N3O6 — CID 139030463
(3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]butanoic acid;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 139030463) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]butanoic acid;(2S)-pyrrolidine-2-carboxylic acid.
| Compound Name | (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]butanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 139030463 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (3S)-3-amino-4-oxo-4-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]butanoic acid;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@H](C=O)Cc1ccccc1.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H16N2O4.C5H9NO2/c14-11(7-12(17)18)13(19)15-10(8-16)6-9-4-2-1-3-5-9;7-5(8)4-2-1-3-6-4/h1-5,8,10-11H,6-7,14H2,(H,15,19)(H,17,18);4,6H,1-3H2,(H,7,8)/t10-,11-;4-/m00/s1 |
| InChIKey | MUVYEBBSJWMIPP-IQWOFYMXSA-N |
| XLogP | -0.46 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|