C40H77NO8P+ — CID 139033901
2-[hydroxy-[(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 139033901) has the molecular formula C40H77NO8P+ and a molecular weight of 731.03 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 139033901 |
| Molecular Formula | C40H77NO8P+ |
| Molecular Weight | 731.03 g/mol |
| Exact Mass | 730.54 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C40H76NO8P/c1-6-8-10-12-14-16-18-19-20-21-23-25-27-29-31-33-40(43)49-38(37-48-50(44,45)47-35-34-41(3,4)5)36-46-39(42)32-30-28-26-24-22-17-15-13-11-9-7-2/h13,15,19-20,38H,6-12,14,16-18,21-37H2,1-5H3/p+1/b15-13+,20-19-/t38-/m1/s1 |
| InChIKey | KFGSHFVDCHWRGE-NOGUOWRUSA-O |
| XLogP | 10.80 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.03 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|