C36H69NO8P+ — CID 5313124
2-[2,3-bis[[(E)-tetradec-9-enoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 5313124) has the molecular formula C36H69NO8P+ and a molecular weight of 674.92 g/mol. Its IUPAC name is 2-[2,3-bis[[(E)-tetradec-9-enoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2,3-bis[[(E)-tetradec-9-enoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 5313124 |
| Molecular Formula | C36H69NO8P+ |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.48 |
| IUPAC Name | 2-[2,3-bis[[(E)-tetradec-9-enoyl]oxy]propoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C/CCCC |
| InChI | InChI=1S/C36H68NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-35(38)42-32-34(33-44-46(40,41)43-31-30-37(3,4)5)45-36(39)29-27-25-23-21-19-17-15-13-11-9-7-2/h12-15,34H,6-11,16-33H2,1-5H3/p+1/b14-12+,15-13+ |
| InChIKey | AVCZHZMYOZARRJ-QUMQEAAQSA-O |
| XLogP | 9.24 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|