C33H65NO8P+ — CID 139210948
2-[hydroxy-[(2S)-2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 139210948) has the molecular formula C33H65NO8P+ and a molecular weight of 634.86 g/mol. Its IUPAC name is 2-[hydroxy-[(2S)-2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2S)-2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 139210948 |
| Molecular Formula | C33H65NO8P+ |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.44 |
| IUPAC Name | 2-[hydroxy-[(2S)-2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C/CCCCCCCC(=O)O[C@@H](COC(=O)CCCCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C33H64NO8P/c1-6-8-10-12-14-16-17-18-20-22-24-26-33(36)42-31(30-41-43(37,38)40-28-27-34(3,4)5)29-39-32(35)25-23-21-19-15-13-11-9-7-2/h12,14,31H,6-11,13,15-30H2,1-5H3/p+1/b14-12+/t31-/m0/s1 |
| InChIKey | JIGIHEWJVVFYCZ-ROWXLNAWSA-O |
| XLogP | 8.29 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|