C24H35I2NO5 — CID 139037138
tert-butyl (2R)-2-[(3aS,4S,5R,8S,8aS,8bR)-8-iodo-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]-2-hydroxyacetate iodide (PubChem CID 139037138) has the molecular formula C24H35I2NO5 and a molecular weight of 671.35 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3aS,4S,5R,8S,8aS,8bR)-8-iodo-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]-2-hydroxyacetate iodide.
| Compound Name | tert-butyl (2R)-2-[(3aS,4S,5R,8S,8aS,8bR)-8-iodo-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]-2-hydroxyacetate iodide |
|---|---|
| PubChem CID | 139037138 |
| Molecular Formula | C24H35I2NO5 |
| Molecular Weight | 671.35 g/mol |
| Exact Mass | 671.06 |
| IUPAC Name | tert-butyl (2R)-2-[(3aS,4S,5R,8S,8aS,8bR)-8-iodo-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4,6,7,8,8a,8b-hexahydro-3aH-[1,3]dioxolo[4,5-a]pyrrolizin-5-ium-4-yl]-2-hydroxyacetate iodide |
| SMILES | C[C@H](c1ccccc1)[N@@+]12CC[C@H](I)[C@@H]1[C@H]1OC(C)(C)O[C@H]1[C@@H]2[C@@H](O)C(=O)OC(C)(C)C.[I-] |
| InChI | InChI=1S/C24H35INO5.HI/c1-14(15-10-8-7-9-11-15)26-13-12-16(25)17(26)20-21(30-24(5,6)29-20)18(26)19(27)22(28)31-23(2,3)4;/h7-11,14,16-21,27H,12-13H2,1-6H3;1H/q+1;/p-1/t14-,16+,17-,18+,19-,20-,21+,26+;/m1./s1 |
| InChIKey | XTDBWNYHPBEMJT-DQZZXPHISA-M |
| XLogP | 0.75 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|