C38H39NO3 — CID 139037267
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-3-isocyanato-2,2,3-triphenylpropanoate (PubChem CID 139037267) has the molecular formula C38H39NO3 and a molecular weight of 557.73 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-3-isocyanato-2,2,3-triphenylpropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-3-isocyanato-2,2,3-triphenylpropanoate |
|---|---|
| PubChem CID | 139037267 |
| Molecular Formula | C38H39NO3 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (3S)-3-isocyanato-2,2,3-triphenylpropanoate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)C(c2ccccc2)(c2ccccc2)[C@@H](N=C=O)c2ccccc2)C1 |
| InChI | InChI=1S/C38H39NO3/c1-28-24-25-33(37(2,3)30-18-10-5-11-19-30)34(26-28)42-36(41)38(31-20-12-6-13-21-31,32-22-14-7-15-23-32)35(39-27-40)29-16-8-4-9-17-29/h4-23,28,33-35H,24-26H2,1-3H3/t28-,33-,34-,35+/m1/s1 |
| InChIKey | JFUGEFMERVRURD-WNANERLGSA-N |
| XLogP | 8.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|