C34H33NO2 — CID 164888116
methyl 1-[(benzhydrylideneamino)-(4-phenylphenyl)methyl]cyclohexane-1-carboxylate (PubChem CID 164888116) has the molecular formula C34H33NO2 and a molecular weight of 487.64 g/mol. Its IUPAC name is methyl 1-[(benzhydrylideneamino)-(4-phenylphenyl)methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(benzhydrylideneamino)-(4-phenylphenyl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 164888116 |
| Molecular Formula | C34H33NO2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | methyl 1-[(benzhydrylideneamino)-(4-phenylphenyl)methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(C(N=C(c2ccccc2)c2ccccc2)c2ccc(-c3ccccc3)cc2)CCCCC1 |
| InChI | InChI=1S/C34H33NO2/c1-37-33(36)34(24-12-5-13-25-34)32(30-22-20-27(21-23-30)26-14-6-2-7-15-26)35-31(28-16-8-3-9-17-28)29-18-10-4-11-19-29/h2-4,6-11,14-23,32H,5,12-13,24-25H2,1H3 |
| InChIKey | BEFZCJXIDDPBMM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|