C31H27NO2 — CID 102338654
methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3,4-diphenylbutanoate (PubChem CID 102338654) has the molecular formula C31H27NO2 and a molecular weight of 445.56 g/mol. Its IUPAC name is methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3,4-diphenylbutanoate.
| Compound Name | methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3,4-diphenylbutanoate |
|---|---|
| PubChem CID | 102338654 |
| Molecular Formula | C31H27NO2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3,4-diphenylbutanoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1)[C@@H](N=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H27NO2/c1-23(31(33)34-2)28(24-15-7-3-8-16-24)30(27-21-13-6-14-22-27)32-29(25-17-9-4-10-18-25)26-19-11-5-12-20-26/h3-22,28,30H,1H2,2H3/t28-,30-/m0/s1 |
| InChIKey | OXACKEVTVZBSMH-JDXGNMNLSA-N |
| XLogP | 6.78 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|