C32H29NO2 — CID 155931345
methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-4-(3-methylphenyl)-3-phenylbutanoate (PubChem CID 155931345) has the molecular formula C32H29NO2 and a molecular weight of 459.59 g/mol. Its IUPAC name is methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-4-(3-methylphenyl)-3-phenylbutanoate.
| Compound Name | methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-4-(3-methylphenyl)-3-phenylbutanoate |
|---|---|
| PubChem CID | 155931345 |
| Molecular Formula | C32H29NO2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-4-(3-methylphenyl)-3-phenylbutanoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1)[C@@H](N=C(c1ccccc1)c1ccccc1)c1cccc(C)c1 |
| InChI | InChI=1S/C32H29NO2/c1-23-14-13-21-28(22-23)31(29(24(2)32(34)35-3)25-15-7-4-8-16-25)33-30(26-17-9-5-10-18-26)27-19-11-6-12-20-27/h4-22,29,31H,2H2,1,3H3/t29-,31-/m0/s1 |
| InChIKey | GJBZLKHRRZJWPB-SMCANUKXSA-N |
| XLogP | 7.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|