C29H25NO2 — CID 164888102
methyl 3-(benzhydrylideneamino)-2,3-diphenylpropanoate (PubChem CID 164888102) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl 3-(benzhydrylideneamino)-2,3-diphenylpropanoate.
| Compound Name | methyl 3-(benzhydrylideneamino)-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 164888102 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | methyl 3-(benzhydrylideneamino)-2,3-diphenylpropanoate |
| SMILES | COC(=O)C(c1ccccc1)C(N=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25NO2/c1-32-29(31)26(22-14-6-2-7-15-22)28(25-20-12-5-13-21-25)30-27(23-16-8-3-9-17-23)24-18-10-4-11-19-24/h2-21,26,28H,1H3 |
| InChIKey | CXSXIOAVTJIKDV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|