C31H26ClNO2 — CID 102338655
methyl (3R,4R)-4-(benzhydrylideneamino)-4-(3-chlorophenyl)-2-methylidene-3-phenylbutanoate (PubChem CID 102338655) has the molecular formula C31H26ClNO2 and a molecular weight of 480.01 g/mol. Its IUPAC name is methyl (3R,4R)-4-(benzhydrylideneamino)-4-(3-chlorophenyl)-2-methylidene-3-phenylbutanoate.
| Compound Name | methyl (3R,4R)-4-(benzhydrylideneamino)-4-(3-chlorophenyl)-2-methylidene-3-phenylbutanoate |
|---|---|
| PubChem CID | 102338655 |
| Molecular Formula | C31H26ClNO2 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | methyl (3R,4R)-4-(benzhydrylideneamino)-4-(3-chlorophenyl)-2-methylidene-3-phenylbutanoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1)[C@@H](N=C(c1ccccc1)c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C31H26ClNO2/c1-22(31(34)35-2)28(23-13-6-3-7-14-23)30(26-19-12-20-27(32)21-26)33-29(24-15-8-4-9-16-24)25-17-10-5-11-18-25/h3-21,28,30H,1H2,2H3/t28-,30-/m0/s1 |
| InChIKey | GMLNOWJIHMYPCO-JDXGNMNLSA-N |
| XLogP | 7.43 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|