C37H31NO2 — CID 155931346
methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3-phenyl-4-(4-phenylphenyl)butanoate (PubChem CID 155931346) has the molecular formula C37H31NO2 and a molecular weight of 521.66 g/mol. Its IUPAC name is methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3-phenyl-4-(4-phenylphenyl)butanoate.
| Compound Name | methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3-phenyl-4-(4-phenylphenyl)butanoate |
|---|---|
| PubChem CID | 155931346 |
| Molecular Formula | C37H31NO2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | methyl (3R,4R)-4-(benzhydrylideneamino)-2-methylidene-3-phenyl-4-(4-phenylphenyl)butanoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1)[C@@H](N=C(c1ccccc1)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H31NO2/c1-27(37(39)40-2)34(30-17-9-4-10-18-30)36(33-25-23-29(24-26-33)28-15-7-3-8-16-28)38-35(31-19-11-5-12-20-31)32-21-13-6-14-22-32/h3-26,34,36H,1H2,2H3/t34-,36-/m0/s1 |
| InChIKey | MBPWLRRTFVBBLW-GIWKVKTRSA-N |
| XLogP | 8.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|