C30H27NO2 — CID 162639846
methyl 2-(benzhydrylideneamino)-2-methyl-3,3-diphenylpropanoate (PubChem CID 162639846) has the molecular formula C30H27NO2 and a molecular weight of 433.55 g/mol. Its IUPAC name is methyl 2-(benzhydrylideneamino)-2-methyl-3,3-diphenylpropanoate.
| Compound Name | methyl 2-(benzhydrylideneamino)-2-methyl-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 162639846 |
| Molecular Formula | C30H27NO2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | methyl 2-(benzhydrylideneamino)-2-methyl-3,3-diphenylpropanoate |
| SMILES | COC(=O)C(C)(N=C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO2/c1-30(29(32)33-2,27(23-15-7-3-8-16-23)24-17-9-4-10-18-24)31-28(25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27H,1-2H3 |
| InChIKey | LBZMQMFMQYKRKB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|