C17H25NO7 — CID 139037290
methyl (3S,3aS,5R,6S,7R,7aS)-5,6-dihydroxy-1-methyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole-3-carboxylate;hydrate (PubChem CID 139037290) has the molecular formula C17H25NO7 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl (3S,3aS,5R,6S,7R,7aS)-5,6-dihydroxy-1-methyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole-3-carboxylate;hydrate.
| Compound Name | methyl (3S,3aS,5R,6S,7R,7aS)-5,6-dihydroxy-1-methyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole-3-carboxylate;hydrate |
|---|---|
| PubChem CID | 139037290 |
| Molecular Formula | C17H25NO7 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl (3S,3aS,5R,6S,7R,7aS)-5,6-dihydroxy-1-methyl-7-phenylmethoxy-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole-3-carboxylate;hydrate |
| SMILES | COC(=O)[C@H]1ON(C)[C@H]2[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2OCc1ccccc1.O |
| InChI | InChI=1S/C17H23NO6.H2O/c1-18-13-11(15(24-18)17(21)22-2)8-12(19)14(20)16(13)23-9-10-6-4-3-5-7-10;/h3-7,11-16,19-20H,8-9H2,1-2H3;1H2/t11-,12+,13-,14-,15-,16+;/m0./s1 |
| InChIKey | SDDYOYTUHQHYST-YDTRKXOJSA-N |
| XLogP | -0.72 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |