C22H23NO3 — CID 139037988
[(1S,6S)-6-nitro-6-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl]oxymethylbenzene (PubChem CID 139037988) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is [(1S,6S)-6-nitro-6-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl]oxymethylbenzene.
| Compound Name | [(1S,6S)-6-nitro-6-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 139037988 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [(1S,6S)-6-nitro-6-[(E)-3-phenylprop-2-enyl]cyclohex-2-en-1-yl]oxymethylbenzene |
| SMILES | O=[N+]([O-])[C@]1(C/C=C/c2ccccc2)CCC=C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c24-23(25)22(17-9-14-19-10-3-1-4-11-19)16-8-7-15-21(22)26-18-20-12-5-2-6-13-20/h1-7,9-15,21H,8,16-18H2/b14-9+/t21-,22-/m0/s1 |
| InChIKey | IBGLTDDRZIDRSN-UOSGHKTGSA-N |
| XLogP | 5.04 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|