C17H23NO4 — CID 11822894
1-nitro-3-[(1S,6S)-6-(phenylmethoxymethyl)cyclohex-2-en-1-yl]propan-2-ol (PubChem CID 11822894) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-nitro-3-[(1S,6S)-6-(phenylmethoxymethyl)cyclohex-2-en-1-yl]propan-2-ol.
| Compound Name | 1-nitro-3-[(1S,6S)-6-(phenylmethoxymethyl)cyclohex-2-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 11822894 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-nitro-3-[(1S,6S)-6-(phenylmethoxymethyl)cyclohex-2-en-1-yl]propan-2-ol |
| SMILES | O=[N+]([O-])CC(O)C[C@H]1C=CCC[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c19-17(11-18(20)21)10-15-8-4-5-9-16(15)13-22-12-14-6-2-1-3-7-14/h1-4,6-8,15-17,19H,5,9-13H2/t15-,16-,17?/m1/s1 |
| InChIKey | SWRBWURITMOFLP-YNPPLXCJSA-N |
| XLogP | 2.81 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|