C11H14O3S2 — CID 15856736
(1R,3R)-2-(phenylmethoxymethyl)-1,3-dithiolane 1,3-dioxide (PubChem CID 15856736) has the molecular formula C11H14O3S2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1R,3R)-2-(phenylmethoxymethyl)-1,3-dithiolane 1,3-dioxide.
| Compound Name | (1R,3R)-2-(phenylmethoxymethyl)-1,3-dithiolane 1,3-dioxide |
|---|---|
| PubChem CID | 15856736 |
| Molecular Formula | C11H14O3S2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (1R,3R)-2-(phenylmethoxymethyl)-1,3-dithiolane 1,3-dioxide |
| SMILES | O=[S@@]1CC[S@@](=O)C1COCc1ccccc1 |
| InChI | InChI=1S/C11H14O3S2/c12-15-6-7-16(13)11(15)9-14-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2/t15-,16-/m1/s1 |
| InChIKey | VZJAPCVCVXWNAL-HZPDHXFCSA-N |
| XLogP | 1.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |