C24H32N2O6 — CID 11091520
[4,5-bis(nitromethyl)-8-phenylmethoxyoctoxy]methylbenzene (PubChem CID 11091520) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is [4,5-bis(nitromethyl)-8-phenylmethoxyoctoxy]methylbenzene.
| Compound Name | [4,5-bis(nitromethyl)-8-phenylmethoxyoctoxy]methylbenzene |
|---|---|
| PubChem CID | 11091520 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [4,5-bis(nitromethyl)-8-phenylmethoxyoctoxy]methylbenzene |
| SMILES | O=[N+]([O-])CC(CCCOCc1ccccc1)C(CCCOCc1ccccc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C24H32N2O6/c27-25(28)17-23(13-7-15-31-19-21-9-3-1-4-10-21)24(18-26(29)30)14-8-16-32-20-22-11-5-2-6-12-22/h1-6,9-12,23-24H,7-8,13-20H2 |
| InChIKey | USDSMWQLXGJMQR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|