C16H19F3N2O5 — CID 46869170
2,2,2-trifluoro-N-[(2S,3S)-3-formyl-1-nitro-6-phenylmethoxyhexan-2-yl]acetamide (PubChem CID 46869170) has the molecular formula C16H19F3N2O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,3S)-3-formyl-1-nitro-6-phenylmethoxyhexan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,3S)-3-formyl-1-nitro-6-phenylmethoxyhexan-2-yl]acetamide |
|---|---|
| PubChem CID | 46869170 |
| Molecular Formula | C16H19F3N2O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,3S)-3-formyl-1-nitro-6-phenylmethoxyhexan-2-yl]acetamide |
| SMILES | O=C[C@@H](CCCOCc1ccccc1)[C@@H](C[N+](=O)[O-])NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O5/c17-16(18,19)15(23)20-14(9-21(24)25)13(10-22)7-4-8-26-11-12-5-2-1-3-6-12/h1-3,5-6,10,13-14H,4,7-9,11H2,(H,20,23)/t13-,14-/m1/s1 |
| InChIKey | NGUGYGSEUMVBSR-ZIAGYGMSSA-N |
| XLogP | 2.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|