C24H24O5 — CID 139038308
dimethyl (3aS,4S,7R,7aR)-5,6-diphenyl-1,3,3a,4,7,7a-hexahydro-2-benzofuran-4,7-dicarboxylate (PubChem CID 139038308) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is dimethyl (3aS,4S,7R,7aR)-5,6-diphenyl-1,3,3a,4,7,7a-hexahydro-2-benzofuran-4,7-dicarboxylate.
| Compound Name | dimethyl (3aS,4S,7R,7aR)-5,6-diphenyl-1,3,3a,4,7,7a-hexahydro-2-benzofuran-4,7-dicarboxylate |
|---|---|
| PubChem CID | 139038308 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | dimethyl (3aS,4S,7R,7aR)-5,6-diphenyl-1,3,3a,4,7,7a-hexahydro-2-benzofuran-4,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(c2ccccc2)=C(c2ccccc2)[C@H](C(=O)OC)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C24H24O5/c1-27-23(25)21-17-13-29-14-18(17)22(24(26)28-2)20(16-11-7-4-8-12-16)19(21)15-9-5-3-6-10-15/h3-12,17-18,21-22H,13-14H2,1-2H3/t17-,18+,21-,22+ |
| InChIKey | NLEQYWDRHJOFCM-VVIORFSUSA-N |
| XLogP | 3.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|