C20H32O8 — CID 139039054
(1S,3S,5S,6R)-6,8,8-trimethyl-2,7,9-trioxatricyclo[4.4.0.01,3]decan-5-ol (PubChem CID 139039054) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is (1S,3S,5S,6R)-6,8,8-trimethyl-2,7,9-trioxatricyclo[4.4.0.01,3]decan-5-ol.
| Compound Name | (1S,3S,5S,6R)-6,8,8-trimethyl-2,7,9-trioxatricyclo[4.4.0.01,3]decan-5-ol |
|---|---|
| PubChem CID | 139039054 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (1S,3S,5S,6R)-6,8,8-trimethyl-2,7,9-trioxatricyclo[4.4.0.01,3]decan-5-ol |
| SMILES | CC1(C)OC[C@]23O[C@H]2C[C@H](O)[C@@]3(C)O1.CC1(C)OC[C@]23O[C@H]2C[C@H](O)[C@@]3(C)O1 |
| InChI | InChI=1S/2C10H16O4/c2*1-8(2)12-5-10-7(13-10)4-6(11)9(10,3)14-8/h2*6-7,11H,4-5H2,1-3H3/t2*6-,7-,9+,10-/m00/s1 |
| InChIKey | QUGSHTHMGZCSIE-LVPPNOTASA-N |
| XLogP | 0.86 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|